C14H9ClIN3O — CID 103222608
5-(3-chloro-4-iodophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine (PubChem CID 103222608) has the molecular formula C14H9ClIN3O and a molecular weight of 397.60 g/mol. Its IUPAC name is 5-(3-chloro-4-iodophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(3-chloro-4-iodophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 103222608 |
| Molecular Formula | C14H9ClIN3O |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | 5-(3-chloro-4-iodophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccc(I)c(Cl)c2)c1-c1ccccn1 |
| InChI | InChI=1S/C14H9ClIN3O/c15-9-7-8(4-5-10(9)16)13-12(14(17)19-20-13)11-3-1-2-6-18-11/h1-7H,(H2,17,19) |
| InChIKey | ZTPSTYMQGHXTPX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|