C18H19F3N2O4 — CID 10452582
dimethyl 2,6-dimethyl-4-[2-(trifluoromethylamino)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10452582) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-[2-(trifluoromethylamino)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-[2-(trifluoromethylamino)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10452582 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-[2-(trifluoromethylamino)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1NC(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O4/c1-9-13(16(24)26-3)15(14(10(2)22-9)17(25)27-4)11-7-5-6-8-12(11)23-18(19,20)21/h5-8,15,22-23H,1-4H3 |
| InChIKey | QZJFSPPSQHRQHL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|