C17H20ClNO2 — CID 104526586
7-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 104526586) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 7-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 7-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 104526586 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 7-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | O=C1NCCOc2ccc(C(Cl)C3C4CCCCC43)cc21 |
| InChI | InChI=1S/C17H20ClNO2/c18-16(15-11-3-1-2-4-12(11)15)10-5-6-14-13(9-10)17(20)19-7-8-21-14/h5-6,9,11-12,15-16H,1-4,7-8H2,(H,19,20) |
| InChIKey | JBOPMHORKHTHGI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|