C17H16N4O5S — CID 10452856
2-[[4-[(2-hydroxyacetyl)amino]phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide (PubChem CID 10452856) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 2-[[4-[(2-hydroxyacetyl)amino]phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[[4-[(2-hydroxyacetyl)amino]phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 10452856 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[[4-[(2-hydroxyacetyl)amino]phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2[nH]c(CS(=O)(=O)c3ccc(NC(=O)CO)cc3)nc12 |
| InChI | InChI=1S/C17H16N4O5S/c18-17(24)12-2-1-3-13-16(12)21-14(20-13)9-27(25,26)11-6-4-10(5-7-11)19-15(23)8-22/h1-7,22H,8-9H2,(H2,18,24)(H,19,23)(H,20,21) |
| InChIKey | YAMUMIONOMKJHP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |