C16H23NO2 — CID 104529359
1-[2-amino-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone (PubChem CID 104529359) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[2-amino-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone.
| Compound Name | 1-[2-amino-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone |
|---|---|
| PubChem CID | 104529359 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[2-amino-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone |
| SMILES | CC(=O)c1ccc(OC2CC(C)CC(C)C2)cc1N |
| InChI | InChI=1S/C16H23NO2/c1-10-6-11(2)8-14(7-10)19-13-4-5-15(12(3)18)16(17)9-13/h4-5,9-11,14H,6-8,17H2,1-3H3 |
| InChIKey | WXGKZTYGFXHSFG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|