C15H21NO3 — CID 113419910
2-amino-4-(3,4-dimethylcyclohexyl)oxybenzoic acid (PubChem CID 113419910) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-amino-4-(3,4-dimethylcyclohexyl)oxybenzoic acid.
| Compound Name | 2-amino-4-(3,4-dimethylcyclohexyl)oxybenzoic acid |
|---|---|
| PubChem CID | 113419910 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-amino-4-(3,4-dimethylcyclohexyl)oxybenzoic acid |
| SMILES | CC1CCC(Oc2ccc(C(=O)O)c(N)c2)CC1C |
| InChI | InChI=1S/C15H21NO3/c1-9-3-4-11(7-10(9)2)19-12-5-6-13(15(17)18)14(16)8-12/h5-6,8-11H,3-4,7,16H2,1-2H3,(H,17,18) |
| InChIKey | XTCRPWHHVJNQKL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|