C23H27N5O — CID 10452949
1-(3-aminoisoquinolin-5-yl)-3-[[4-(azepan-1-yl)phenyl]methyl]urea (PubChem CID 10452949) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-(3-aminoisoquinolin-5-yl)-3-[[4-(azepan-1-yl)phenyl]methyl]urea.
| Compound Name | 1-(3-aminoisoquinolin-5-yl)-3-[[4-(azepan-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 10452949 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-(3-aminoisoquinolin-5-yl)-3-[[4-(azepan-1-yl)phenyl]methyl]urea |
| SMILES | Nc1cc2c(NC(=O)NCc3ccc(N4CCCCCC4)cc3)cccc2cn1 |
| InChI | InChI=1S/C23H27N5O/c24-22-14-20-18(16-25-22)6-5-7-21(20)27-23(29)26-15-17-8-10-19(11-9-17)28-12-3-1-2-4-13-28/h5-11,14,16H,1-4,12-13,15H2,(H2,24,25)(H2,26,27,29) |
| InChIKey | NXWKXRQXUDWDHI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|