C17H21NOS — CID 104531266
N-[furan-2-yl(phenyl)methyl]-3-methylsulfanylcyclopentan-1-amine (PubChem CID 104531266) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[furan-2-yl(phenyl)methyl]-3-methylsulfanylcyclopentan-1-amine.
| Compound Name | N-[furan-2-yl(phenyl)methyl]-3-methylsulfanylcyclopentan-1-amine |
|---|---|
| PubChem CID | 104531266 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[furan-2-yl(phenyl)methyl]-3-methylsulfanylcyclopentan-1-amine |
| SMILES | CSC1CCC(NC(c2ccccc2)c2ccco2)C1 |
| InChI | InChI=1S/C17H21NOS/c1-20-15-10-9-14(12-15)18-17(16-8-5-11-19-16)13-6-3-2-4-7-13/h2-8,11,14-15,17-18H,9-10,12H2,1H3 |
| InChIKey | BRVFNWGEPMPWCI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |