C16H18N4 — CID 104534184
4-[[[5-(propylamino)-3-pyridinyl]amino]methyl]benzonitrile (PubChem CID 104534184) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-[[[5-(propylamino)-3-pyridinyl]amino]methyl]benzonitrile.
| Compound Name | 4-[[[5-(propylamino)-3-pyridinyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 104534184 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-[[[5-(propylamino)-3-pyridinyl]amino]methyl]benzonitrile |
| SMILES | CCCNc1cncc(NCc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C16H18N4/c1-2-7-19-15-8-16(12-18-11-15)20-10-14-5-3-13(9-17)4-6-14/h3-6,8,11-12,19-20H,2,7,10H2,1H3 |
| InChIKey | MYMLKEKCCJTKDK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |