C14H18N4 — CID 104532744
3-N-propyl-5-N-(pyridin-4-ylmethyl)pyridine-3,5-diamine (PubChem CID 104532744) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 3-N-propyl-5-N-(pyridin-4-ylmethyl)pyridine-3,5-diamine.
| Compound Name | 3-N-propyl-5-N-(pyridin-4-ylmethyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532744 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3-N-propyl-5-N-(pyridin-4-ylmethyl)pyridine-3,5-diamine |
| SMILES | CCCNc1cncc(NCc2ccncc2)c1 |
| InChI | InChI=1S/C14H18N4/c1-2-5-17-13-8-14(11-16-10-13)18-9-12-3-6-15-7-4-12/h3-4,6-8,10-11,17-18H,2,5,9H2,1H3 |
| InChIKey | AWBRIUWFWLAKKI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |