C24H24F3NO — CID 10453544
N-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-(3-methylphenyl)ethanamine (PubChem CID 10453544) has the molecular formula C24H24F3NO and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-(3-methylphenyl)ethanamine.
| Compound Name | N-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 10453544 |
| Molecular Formula | C24H24F3NO |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-(3-methylphenyl)ethanamine |
| SMILES | COc1ccc(CNC(C)c2cccc(C)c2)cc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3NO/c1-16-5-4-6-20(13-16)17(2)28-15-18-7-12-23(29-3)22(14-18)19-8-10-21(11-9-19)24(25,26)27/h4-14,17,28H,15H2,1-3H3 |
| InChIKey | DPVDYMFQKDPRNX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |