C21H27NO3SSi — CID 10453697
tert-butyl-dimethyl-[(Z,1R)-3-nitro-1-phenyl-3-phenylsulfanylprop-2-enoxy]silane (PubChem CID 10453697) has the molecular formula C21H27NO3SSi and a molecular weight of 401.60 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,1R)-3-nitro-1-phenyl-3-phenylsulfanylprop-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z,1R)-3-nitro-1-phenyl-3-phenylsulfanylprop-2-enoxy]silane |
|---|---|
| PubChem CID | 10453697 |
| Molecular Formula | C21H27NO3SSi |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,1R)-3-nitro-1-phenyl-3-phenylsulfanylprop-2-enoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C(\Sc1ccccc1)[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C21H27NO3SSi/c1-21(2,3)27(4,5)25-19(17-12-8-6-9-13-17)16-20(22(23)24)26-18-14-10-7-11-15-18/h6-16,19H,1-5H3/b20-16-/t19-/m1/s1 |
| InChIKey | XEZPFMZOKFLHNT-WDULPBOOSA-N |
| XLogP | 6.66 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|