C13H16N6OS — CID 104539212
4-[1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]butan-1-amine (PubChem CID 104539212) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-[1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]butan-1-amine.
| Compound Name | 4-[1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 104539212 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]butan-1-amine |
| SMILES | NCCCCc1cn(Cc2nc(-c3cccs3)no2)nn1 |
| InChI | InChI=1S/C13H16N6OS/c14-6-2-1-4-10-8-19(18-16-10)9-12-15-13(17-20-12)11-5-3-7-21-11/h3,5,7-8H,1-2,4,6,9,14H2 |
| InChIKey | OTVQKSWLWHSYEN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|