C25H30N2O3 — CID 10454019
4-[2-[2-(2,2-diphenylethylamino)ethylamino]-1-hydroxypropyl]benzene-1,2-diol (PubChem CID 10454019) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[2-[2-(2,2-diphenylethylamino)ethylamino]-1-hydroxypropyl]benzene-1,2-diol.
| Compound Name | 4-[2-[2-(2,2-diphenylethylamino)ethylamino]-1-hydroxypropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 10454019 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-[2-[2-(2,2-diphenylethylamino)ethylamino]-1-hydroxypropyl]benzene-1,2-diol |
| SMILES | CC(NCCNCC(c1ccccc1)c1ccccc1)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H30N2O3/c1-18(25(30)21-12-13-23(28)24(29)16-21)27-15-14-26-17-22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-13,16,18,22,25-30H,14-15,17H2,1H3 |
| InChIKey | YLTPZRWOPOXAIL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|