C11H15N5 — CID 104540597
3-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3-diamine (PubChem CID 104540597) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3-diamine.
| Compound Name | 3-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104540597 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3-diamine |
| SMILES | Cn1cc(CCNc2cccnc2N)cn1 |
| InChI | InChI=1S/C11H15N5/c1-16-8-9(7-15-16)4-6-13-10-3-2-5-14-11(10)12/h2-3,5,7-8,13H,4,6H2,1H3,(H2,12,14) |
| InChIKey | VJGOTHFRORLXGM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |