C11H16N6 — CID 80680913
6-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3,6-triamine (PubChem CID 80680913) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 6-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3,6-triamine.
| Compound Name | 6-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 80680913 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 6-N-[2-(1-methylpyrazol-4-yl)ethyl]pyridine-2,3,6-triamine |
| SMILES | Cn1cc(CCNc2ccc(N)c(N)n2)cn1 |
| InChI | InChI=1S/C11H16N6/c1-17-7-8(6-15-17)4-5-14-10-3-2-9(12)11(13)16-10/h2-3,6-7H,4-5,12H2,1H3,(H3,13,14,16) |
| InChIKey | KMGBQBNWSFWBFR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |