C13H15ClN4 — CID 79826434
6-N-[2-(4-chlorophenyl)ethyl]pyridine-2,3,6-triamine (PubChem CID 79826434) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 6-N-[2-(4-chlorophenyl)ethyl]pyridine-2,3,6-triamine.
| Compound Name | 6-N-[2-(4-chlorophenyl)ethyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79826434 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-N-[2-(4-chlorophenyl)ethyl]pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(NCCc2ccc(Cl)cc2)nc1N |
| InChI | InChI=1S/C13H15ClN4/c14-10-3-1-9(2-4-10)7-8-17-12-6-5-11(15)13(16)18-12/h1-6H,7-8,15H2,(H3,16,17,18) |
| InChIKey | SQFHUEAESQTYEF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |