C11H9ClF4O2 — CID 104543146
1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 104543146) has the molecular formula C11H9ClF4O2 and a molecular weight of 284.64 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 104543146 |
| Molecular Formula | C11H9ClF4O2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | OC(c1cc(Cl)cc2c1OCC2)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H9ClF4O2/c12-6-3-5-1-2-18-8(5)7(4-6)9(17)11(15,16)10(13)14/h3-4,9-10,17H,1-2H2 |
| InChIKey | YLIJSWIPXODZQT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|