C16H12BrClF2O — CID 104543299
5-bromo-7-[1-chloro-2-(2,4-difluorophenyl)ethyl]-2,3-dihydro-1-benzofuran (PubChem CID 104543299) has the molecular formula C16H12BrClF2O and a molecular weight of 373.62 g/mol. Its IUPAC name is 5-bromo-7-[1-chloro-2-(2,4-difluorophenyl)ethyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-[1-chloro-2-(2,4-difluorophenyl)ethyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543299 |
| Molecular Formula | C16H12BrClF2O |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 5-bromo-7-[1-chloro-2-(2,4-difluorophenyl)ethyl]-2,3-dihydro-1-benzofuran |
| SMILES | Fc1ccc(CC(Cl)c2cc(Br)cc3c2OCC3)c(F)c1 |
| InChI | InChI=1S/C16H12BrClF2O/c17-11-5-10-3-4-21-16(10)13(7-11)14(18)6-9-1-2-12(19)8-15(9)20/h1-2,5,7-8,14H,3-4,6H2 |
| InChIKey | JDIJCXRBXMRISO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|