C18H30ClNO — CID 104546055
1-(5-chloro-2-methoxyphenyl)-2-ethyl-N-propylhexan-1-amine (PubChem CID 104546055) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2-ethyl-N-propylhexan-1-amine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2-ethyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 104546055 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2-ethyl-N-propylhexan-1-amine |
| SMILES | CCCCC(CC)C(NCCC)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C18H30ClNO/c1-5-8-9-14(7-3)18(20-12-6-2)16-13-15(19)10-11-17(16)21-4/h10-11,13-14,18,20H,5-9,12H2,1-4H3 |
| InChIKey | OCIYMKCVCUPXKZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |