C26H48N2O2 — CID 10454835
8-methyl-8-[10-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)decyl]-8-azoniabicyclo[3.2.1]octan-3-olate (PubChem CID 10454835) has the molecular formula C26H48N2O2 and a molecular weight of 420.68 g/mol. Its IUPAC name is 8-methyl-8-[10-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)decyl]-8-azoniabicyclo[3.2.1]octan-3-olate.
| Compound Name | 8-methyl-8-[10-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)decyl]-8-azoniabicyclo[3.2.1]octan-3-olate |
|---|---|
| PubChem CID | 10454835 |
| Molecular Formula | C26H48N2O2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.37 |
| IUPAC Name | 8-methyl-8-[10-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)decyl]-8-azoniabicyclo[3.2.1]octan-3-olate |
| SMILES | C[N+]1(CCCCCCCCCC[N+]2(C)C3CCC2CC([O-])C3)C2CCC1CC([O-])C2 |
| InChI | InChI=1S/C26H48N2O2/c1-27(21-11-12-22(27)18-25(29)17-21)15-9-7-5-3-4-6-8-10-16-28(2)23-13-14-24(28)20-26(30)19-23/h21-26H,3-20H2,1-2H3 |
| InChIKey | XIWOWINVZOUOCG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|