C12H17NO3 — CID 104549275
[2-(3,3-dimethoxyazetidin-1-yl)phenyl]methanol (PubChem CID 104549275) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is [2-(3,3-dimethoxyazetidin-1-yl)phenyl]methanol.
| Compound Name | [2-(3,3-dimethoxyazetidin-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 104549275 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | [2-(3,3-dimethoxyazetidin-1-yl)phenyl]methanol |
| SMILES | COC1(OC)CN(c2ccccc2CO)C1 |
| InChI | InChI=1S/C12H17NO3/c1-15-12(16-2)8-13(9-12)11-6-4-3-5-10(11)7-14/h3-6,14H,7-9H2,1-2H3 |
| InChIKey | PLZKMWPDXWFWKQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|