C12H23NO2 — CID 104550086
2-(2-azaspiro[3.6]decan-2-yl)propane-1,3-diol (PubChem CID 104550086) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(2-azaspiro[3.6]decan-2-yl)propane-1,3-diol.
| Compound Name | 2-(2-azaspiro[3.6]decan-2-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 104550086 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-(2-azaspiro[3.6]decan-2-yl)propane-1,3-diol |
| SMILES | OCC(CO)N1CC2(CCCCCC2)C1 |
| InChI | InChI=1S/C12H23NO2/c14-7-11(8-15)13-9-12(10-13)5-3-1-2-4-6-12/h11,14-15H,1-10H2 |
| InChIKey | UAYYPRBIEORUHF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |