C12H22N2OS — CID 104551255
2-[(2-amino-1-thiophen-3-ylbutyl)-methylamino]propan-1-ol (PubChem CID 104551255) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-[(2-amino-1-thiophen-3-ylbutyl)-methylamino]propan-1-ol.
| Compound Name | 2-[(2-amino-1-thiophen-3-ylbutyl)-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 104551255 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[(2-amino-1-thiophen-3-ylbutyl)-methylamino]propan-1-ol |
| SMILES | CCC(N)C(c1ccsc1)N(C)C(C)CO |
| InChI | InChI=1S/C12H22N2OS/c1-4-11(13)12(10-5-6-16-8-10)14(3)9(2)7-15/h5-6,8-9,11-12,15H,4,7,13H2,1-3H3 |
| InChIKey | DCQBMHJIDPDHGZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |