C24H24F3NO3 — CID 10455429
2,2-dimethyl-6-[4-[4-(trifluoromethyl)phenyl]quinolin-2-yl]oxyhexanoic acid (PubChem CID 10455429) has the molecular formula C24H24F3NO3 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2,2-dimethyl-6-[4-[4-(trifluoromethyl)phenyl]quinolin-2-yl]oxyhexanoic acid.
| Compound Name | 2,2-dimethyl-6-[4-[4-(trifluoromethyl)phenyl]quinolin-2-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 10455429 |
| Molecular Formula | C24H24F3NO3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2,2-dimethyl-6-[4-[4-(trifluoromethyl)phenyl]quinolin-2-yl]oxyhexanoic acid |
| SMILES | CC(C)(CCCCOc1cc(-c2ccc(C(F)(F)F)cc2)c2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C24H24F3NO3/c1-23(2,22(29)30)13-5-6-14-31-21-15-19(18-7-3-4-8-20(18)28-21)16-9-11-17(12-10-16)24(25,26)27/h3-4,7-12,15H,5-6,13-14H2,1-2H3,(H,29,30) |
| InChIKey | XDLDZRQBEVLLNY-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|