C10H15BrN2 — CID 104555263
N-(1-bromopropan-2-yl)-N,3-dimethylpyridin-2-amine (PubChem CID 104555263) has the molecular formula C10H15BrN2 and a molecular weight of 243.15 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-N,3-dimethylpyridin-2-amine.
| Compound Name | N-(1-bromopropan-2-yl)-N,3-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 104555263 |
| Molecular Formula | C10H15BrN2 |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | N-(1-bromopropan-2-yl)-N,3-dimethylpyridin-2-amine |
| SMILES | Cc1cccnc1N(C)C(C)CBr |
| InChI | InChI=1S/C10H15BrN2/c1-8-5-4-6-12-10(8)13(3)9(2)7-11/h4-6,9H,7H2,1-3H3 |
| InChIKey | PCJVAQMKVONTDB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|