C12H16BrN3S — CID 104555275
N-(1-bromopropan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 104555275) has the molecular formula C12H16BrN3S and a molecular weight of 314.25 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(1-bromopropan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 104555275 |
| Molecular Formula | C12H16BrN3S |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-(1-bromopropan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2ncnc(N(C)C(C)CBr)c2c1C |
| InChI | InChI=1S/C12H16BrN3S/c1-7(5-13)16(4)11-10-8(2)9(3)17-12(10)15-6-14-11/h6-7H,5H2,1-4H3 |
| InChIKey | GOWACTWDNBPADZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|