C16H18N4S — CID 60869060
N-[(2-aminophenyl)methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 60869060) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-aminophenyl)methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 60869060 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2ncnc(N(C)Cc3ccccc3N)c2c1C |
| InChI | InChI=1S/C16H18N4S/c1-10-11(2)21-16-14(10)15(18-9-19-16)20(3)8-12-6-4-5-7-13(12)17/h4-7,9H,8,17H2,1-3H3 |
| InChIKey | BCNGVYKWBSXTHX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|