C22H15ClN4S2 — CID 10455613
7-(4-chlorophenyl)sulfanyl-3,6-diphenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 10455613) has the molecular formula C22H15ClN4S2 and a molecular weight of 434.98 g/mol. Its IUPAC name is 7-(4-chlorophenyl)sulfanyl-3,6-diphenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 7-(4-chlorophenyl)sulfanyl-3,6-diphenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 10455613 |
| Molecular Formula | C22H15ClN4S2 |
| Molecular Weight | 434.98 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 7-(4-chlorophenyl)sulfanyl-3,6-diphenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Clc1ccc(SC2Sc3nnc(-c4ccccc4)n3N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H15ClN4S2/c23-17-11-13-18(14-12-17)28-21-19(15-7-3-1-4-8-15)26-27-20(24-25-22(27)29-21)16-9-5-2-6-10-16/h1-14,21H |
| InChIKey | XMVRNFFZFMIVRE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.98 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |