C13H10ClN7S — CID 171988905
6-(4-chlorophenyl)-3-methyl-7-(1,2,4-triazol-1-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 171988905) has the molecular formula C13H10ClN7S and a molecular weight of 331.79 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-methyl-7-(1,2,4-triazol-1-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(4-chlorophenyl)-3-methyl-7-(1,2,4-triazol-1-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 171988905 |
| Molecular Formula | C13H10ClN7S |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 6-(4-chlorophenyl)-3-methyl-7-(1,2,4-triazol-1-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Cc1nnc2n1N=C(c1ccc(Cl)cc1)C(n1cncn1)S2 |
| InChI | InChI=1S/C13H10ClN7S/c1-8-17-18-13-21(8)19-11(9-2-4-10(14)5-3-9)12(22-13)20-7-15-6-16-20/h2-7,12H,1H3 |
| InChIKey | CFVRKPORIIDLHT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |