C5H10BrF2NO2S — CID 104556430
N-(1-bromopropan-2-yl)-1,1-difluoro-N-methylmethanesulfonamide (PubChem CID 104556430) has the molecular formula C5H10BrF2NO2S and a molecular weight of 266.11 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-1,1-difluoro-N-methylmethanesulfonamide.
| Compound Name | N-(1-bromopropan-2-yl)-1,1-difluoro-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 104556430 |
| Molecular Formula | C5H10BrF2NO2S |
| Molecular Weight | 266.11 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | N-(1-bromopropan-2-yl)-1,1-difluoro-N-methylmethanesulfonamide |
| SMILES | CC(CBr)N(C)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C5H10BrF2NO2S/c1-4(3-6)9(2)12(10,11)5(7)8/h4-5H,3H2,1-2H3 |
| InChIKey | ZPYTWJHKTVUJHO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|