C19H28N2 — CID 104557329
5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 104557329) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 104557329 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1cc2c(c(CN3CCCC4CCCCC43)c1)CCNC2 |
| InChI | InChI=1S/C19H28N2/c1-2-9-19-15(5-1)8-4-12-21(19)14-17-7-3-6-16-13-20-11-10-18(16)17/h3,6-7,15,19-20H,1-2,4-5,8-14H2 |
| InChIKey | KFFMRWIMMRKFLT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |