C23H25N3O7 — CID 10456688
3-(1,3-benzodioxol-5-yl)-2-[2-(diethylamino)ethyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 10456688) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-[2-(diethylamino)ethyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-[2-(diethylamino)ethyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 10456688 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-[2-(diethylamino)ethyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | CCN(CC)CCN1C(=O)c2ccc([N+](=O)[O-])cc2C(C(=O)O)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H25N3O7/c1-3-24(4-2)9-10-25-21(14-5-8-18-19(11-14)33-13-32-18)20(23(28)29)17-12-15(26(30)31)6-7-16(17)22(25)27/h5-8,11-12,20-21H,3-4,9-10,13H2,1-2H3,(H,28,29) |
| InChIKey | GBKFEBXZRVZFHW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|