C20H12F6N2O4 — CID 10456839
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-nitrobenzamide (PubChem CID 10456839) has the molecular formula C20H12F6N2O4 and a molecular weight of 458.31 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-nitrobenzamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 10456839 |
| Molecular Formula | C20H12F6N2O4 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-nitrobenzamide |
| SMILES | O=C(Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12F6N2O4/c21-19(22,23)18(30,20(24,25)26)15-9-8-11-4-1-2-7-14(11)16(15)27-17(29)12-5-3-6-13(10-12)28(31)32/h1-10,30H,(H,27,29) |
| InChIKey | HOIHZGNFCAITAJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|