C20H12F6INO2 — CID 10459906
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-iodobenzamide (PubChem CID 10459906) has the molecular formula C20H12F6INO2 and a molecular weight of 539.21 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-iodobenzamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-iodobenzamide |
|---|---|
| PubChem CID | 10459906 |
| Molecular Formula | C20H12F6INO2 |
| Molecular Weight | 539.21 g/mol |
| Exact Mass | 538.98 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-iodobenzamide |
| SMILES | O=C(Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H12F6INO2/c21-19(22,23)18(30,20(24,25)26)15-10-7-11-3-1-2-4-14(11)16(15)28-17(29)12-5-8-13(27)9-6-12/h1-10,30H,(H,28,29) |
| InChIKey | NKOQDJNKUIVVCI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.21 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|