C19H17F6NO2 — CID 10092671
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopentanecarboxamide (PubChem CID 10092671) has the molecular formula C19H17F6NO2 and a molecular weight of 405.34 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopentanecarboxamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 10092671 |
| Molecular Formula | C19H17F6NO2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12)C1CCCC1 |
| InChI | InChI=1S/C19H17F6NO2/c20-18(21,22)17(28,19(23,24)25)14-10-9-11-5-3-4-8-13(11)15(14)26-16(27)12-6-1-2-7-12/h3-5,8-10,12,28H,1-2,6-7H2,(H,26,27) |
| InChIKey | GMINMARIXZSRNX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |