C18H15F6NO2 — CID 10318275
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-methylbut-2-enamide (PubChem CID 10318275) has the molecular formula C18H15F6NO2 and a molecular weight of 391.31 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-methylbut-2-enamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 10318275 |
| Molecular Formula | C18H15F6NO2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C18H15F6NO2/c1-10(2)9-14(26)25-15-12-6-4-3-5-11(12)7-8-13(15)16(27,17(19,20)21)18(22,23)24/h3-9,27H,1-2H3,(H,25,26) |
| InChIKey | ZJEWUZAKMLXIOP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|