C17H15F6NO2 — CID 10022595
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]butanamide (PubChem CID 10022595) has the molecular formula C17H15F6NO2 and a molecular weight of 379.30 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]butanamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 10022595 |
| Molecular Formula | C17H15F6NO2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]butanamide |
| SMILES | CCCC(=O)Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C17H15F6NO2/c1-2-5-13(25)24-14-11-7-4-3-6-10(11)8-9-12(14)15(26,16(18,19)20)17(21,22)23/h3-4,6-9,26H,2,5H2,1H3,(H,24,25) |
| InChIKey | SLPMCBMOZLHBFA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |