C18H15F6NO2 — CID 10045948
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclobutanecarboxamide (PubChem CID 10045948) has the molecular formula C18H15F6NO2 and a molecular weight of 391.31 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclobutanecarboxamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 10045948 |
| Molecular Formula | C18H15F6NO2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12)C1CCC1 |
| InChI | InChI=1S/C18H15F6NO2/c19-17(20,21)16(27,18(22,23)24)13-9-8-10-4-1-2-7-12(10)14(13)25-15(26)11-5-3-6-11/h1-2,4,7-9,11,27H,3,5-6H2,(H,25,26) |
| InChIKey | PVDMPFVJYDPLCZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |