C9H16F3NOS — CID 104568573
3-(2-ethylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 104568573) has the molecular formula C9H16F3NOS and a molecular weight of 243.29 g/mol. Its IUPAC name is 3-(2-ethylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(2-ethylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 104568573 |
| Molecular Formula | C9H16F3NOS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-(2-ethylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCC1CN(CC(O)C(F)(F)F)CCS1 |
| InChI | InChI=1S/C9H16F3NOS/c1-2-7-5-13(3-4-15-7)6-8(14)9(10,11)12/h7-8,14H,2-6H2,1H3 |
| InChIKey | IQQKTMJJJUDXNJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |