C7H12F3NOS — CID 1484901
(2R)-1,1,1-trifluoro-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 1484901) has the molecular formula C7H12F3NOS and a molecular weight of 215.24 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 1484901 |
| Molecular Formula | C7H12F3NOS |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | O[C@H](CN1CCSCC1)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NOS/c8-7(9,10)6(12)5-11-1-3-13-4-2-11/h6,12H,1-5H2/t6-/m1/s1 |
| InChIKey | VULXDDBOUZXLRM-ZCFIWIBFSA-N |
| XLogP | 0.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |