C11H20N2O5S2 — CID 104569215
2-[2-[(1-ethylsulfonylpiperidin-4-yl)amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569215) has the molecular formula C11H20N2O5S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[2-[(1-ethylsulfonylpiperidin-4-yl)amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[(1-ethylsulfonylpiperidin-4-yl)amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569215 |
| Molecular Formula | C11H20N2O5S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[2-[(1-ethylsulfonylpiperidin-4-yl)amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CCS(=O)(=O)N1CCC(NC(=O)CSCC(=O)O)CC1 |
| InChI | InChI=1S/C11H20N2O5S2/c1-2-20(17,18)13-5-3-9(4-6-13)12-10(14)7-19-8-11(15)16/h9H,2-8H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | NYKQJDXVYUOZQK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |