C13H18N4O3S — CID 104569240
2-[2-oxo-2-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]ethyl]sulfanylacetic acid (PubChem CID 104569240) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[2-oxo-2-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569240 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[2-oxo-2-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]ethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H18N4O3S/c18-11(8-21-9-12(19)20)16-10-2-6-17(7-3-10)13-14-4-1-5-15-13/h1,4-5,10H,2-3,6-9H2,(H,16,18)(H,19,20) |
| InChIKey | LUXDLDNJRDTIJP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |