C12H20N2O3S — CID 104569543
2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569543) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569543 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C12H20N2O3S/c15-11(8-18-9-12(16)17)14-6-5-13-4-2-1-3-10(13)7-14/h10H,1-9H2,(H,16,17) |
| InChIKey | PNKATRHNMZRJGF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |