C9H17N3O — CID 78942270
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide (PubChem CID 78942270) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 78942270 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
| SMILES | NC(=O)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C9H17N3O/c10-9(13)12-6-5-11-4-2-1-3-8(11)7-12/h8H,1-7H2,(H2,10,13) |
| InChIKey | CTPOGGACVZOCHK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |