C12H21N3O — CID 114994976
(2-aminocyclopropyl)-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone (PubChem CID 114994976) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is (2-aminocyclopropyl)-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (2-aminocyclopropyl)-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 114994976 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (2-aminocyclopropyl)-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone |
| SMILES | NC1CC1C(=O)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C12H21N3O/c13-11-7-10(11)12(16)15-6-5-14-4-2-1-3-9(14)8-15/h9-11H,1-8,13H2 |
| InChIKey | JDVNFTZJPCEBFT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |