C18H23FN2O — CID 95590084
[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]methanone (PubChem CID 95590084) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]methanone.
| Compound Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 95590084 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]methanone |
| SMILES | O=C([C@@H]1C[C@@H]1c1ccc(F)cc1)N1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C18H23FN2O/c19-14-6-4-13(5-7-14)16-11-17(16)18(22)21-10-9-20-8-2-1-3-15(20)12-21/h4-7,15-17H,1-3,8-12H2/t15-,16-,17-/m1/s1 |
| InChIKey | KECVSVBKKUZHJP-BRWVUGGUSA-N |
| XLogP | 2.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |