C17H21FN2O — CID 71936510
(4-cyclopropylpiperazin-1-yl)-[2-(3-fluorophenyl)cyclopropyl]methanone (PubChem CID 71936510) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is (4-cyclopropylpiperazin-1-yl)-[2-(3-fluorophenyl)cyclopropyl]methanone.
| Compound Name | (4-cyclopropylpiperazin-1-yl)-[2-(3-fluorophenyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 71936510 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (4-cyclopropylpiperazin-1-yl)-[2-(3-fluorophenyl)cyclopropyl]methanone |
| SMILES | O=C(C1CC1c1cccc(F)c1)N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C17H21FN2O/c18-13-3-1-2-12(10-13)15-11-16(15)17(21)20-8-6-19(7-9-20)14-4-5-14/h1-3,10,14-16H,4-9,11H2 |
| InChIKey | WJHBGBPUIJXHOJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |