C14H18ClFN2O — CID 119412312
[(3R)-3-aminopyrrolidin-1-yl]-[2-(3-fluorophenyl)cyclopropyl]methanone;hydrochloride (PubChem CID 119412312) has the molecular formula C14H18ClFN2O and a molecular weight of 284.76 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[2-(3-fluorophenyl)cyclopropyl]methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[2-(3-fluorophenyl)cyclopropyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119412312 |
| Molecular Formula | C14H18ClFN2O |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[2-(3-fluorophenyl)cyclopropyl]methanone;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)C2CC2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H17FN2O.ClH/c15-10-3-1-2-9(6-10)12-7-13(12)14(18)17-5-4-11(16)8-17;/h1-3,6,11-13H,4-5,7-8,16H2;1H/t11-,12?,13?;/m1./s1 |
| InChIKey | PZRSRLRFZMWQAN-PATAVHRISA-N |
| XLogP | 1.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |