C9H13N3O3S — CID 104569715
2-[2-[(1-methylpyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569715) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-[2-[(1-methylpyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[(1-methylpyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569715 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[2-[(1-methylpyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | Cn1cc(CNC(=O)CSCC(=O)O)cn1 |
| InChI | InChI=1S/C9H13N3O3S/c1-12-4-7(3-11-12)2-10-8(13)5-16-6-9(14)15/h3-4H,2,5-6H2,1H3,(H,10,13)(H,14,15) |
| InChIKey | VFNSKPMUGLJXIH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |